Products 71467-80-6
CAS 71467-80-6 is the registry number for Ethyl 2-[N-(4-methyl-2-nitrophenyl)methanesulfonamido]acetate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 2-(4-methyl-N-methylsulfonyl-2-nitroanilino)acetate (CAS 71467-80-6) is a chemical compound with the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. IUPAC name: ethyl 2-(4-methyl-N-methylsulfonyl-2-nitroanilino)acetate. InChIKey: YUUWOUYAKSCDEL-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O6S |
|---|---|
| Molecular weight | 316.33 g/mol |
| IUPAC name | ethyl 2-(4-methyl-N-methylsulfonyl-2-nitroanilino)acetate |
| InChIKey | YUUWOUYAKSCDEL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN(C1=C(C=C(C=C1)C)[N+](=O)[O-])S(=O)(=O)C |
Computed by PubChem (NCBI)