Products 68239-81-6
CAS 68239-81-6 appears in our catalog under these names: 3–Aminophenol hemisulfate, m-Aminophenolsulfate, 3-Aminophenol sulfate (2:1), 98%+,RG, 98%+,RG. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 500mg, 250mg, 1000mg, 2000mg, 25g, 100g.
Bis(3-aminophenol);sulfuric acid (CAS 68239-81-6) is a chemical compound with the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. IUPAC name: bis(3-aminophenol);sulfuric acid. InChIKey: TVBNHNUPRXSKHS-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O6S |
|---|---|
| Molecular weight | 316.33 g/mol |
| IUPAC name | bis(3-aminophenol);sulfuric acid |
| InChIKey | TVBNHNUPRXSKHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)N.C1=CC(=CC(=C1)O)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)