CAS 1443981-41-6 appears in our catalog under these names: bis(6-methyl-1,2-dihydropyridin-2-one) sulfuric acid, 95%, Bis(6-methyl-1,2-dihydropyridin-2-one), sulfuric acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Bis(6-methyl-1H-pyridin-2-one);sulfuric acid (CAS 1443981-41-6) is a chemical compound with the molecular formula C12H16N2O6S and a molecular weight of 316.33 g/mol. IUPAC name: bis(6-methyl-1H-pyridin-2-one);sulfuric acid. InChIKey: XNEIWYITXOCSKQ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O6S |
|---|---|
| Molecular weight | 316.33 g/mol |
| IUPAC name | bis(6-methyl-1H-pyridin-2-one);sulfuric acid |
| InChIKey | XNEIWYITXOCSKQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC(=O)N1.CC1=CC=CC(=O)N1.OS(=O)(=O)O |
Computed by PubChem (NCBI)