cas: 336182-06-0 — see every product listed under this CAS number, including other names
Boc–β–homo–Gln–OH (CAS 336182-06-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GA10772-1000 |
| cas | 336182-06-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 2183.73 Pln | |
| GLPBio | 100g | 13000.36 Pln | |
| GLPBio | 25g | 6934.44 Pln | |
| GLPBio | 5g | 3948.28 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid (CAS 336182-06-0) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid. InChIKey: DAUHTFNYHSOVRQ-ZETCQYMHSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid |
| InChIKey | DAUHTFNYHSOVRQ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)