cas: 336182-06-0 — see every product listed under this CAS number, including other names
Boc-β-HoGln-OH, 97%, 97% (CAS 336182-06-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C80B-250mg |
| cas | 336182-06-0 |
| size | 250mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 100mg | 170.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid (CAS 336182-06-0) is a chemical compound with the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. IUPAC name: (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid. InChIKey: DAUHTFNYHSOVRQ-ZETCQYMHSA-N.
| Molecular formula | C11H20N2O5 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (3S)-6-amino-3-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid |
| InChIKey | DAUHTFNYHSOVRQ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)