CAS 119434-75-2 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–3–(thiazol–4–yl)propanoic acid, (S)-2-((tert-Butoxycarbonyl)amino)-3-(thiazol-4-yl)propanoic acid, 97%, 97%, (S)-2-((tert-Butoxycarbonyl)amino)-3-(thiazol-4-yl)propanoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 10g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-thiazol-4-yl)propanoic acid (CAS 119434-75-2) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-thiazol-4-yl)propanoic acid. InChIKey: RVXBTZJECMMZSB-QMMMGPOBSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1,3-thiazol-4-yl)propanoic acid |
| InChIKey | RVXBTZJECMMZSB-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CSC=N1)C(=O)O |
Computed by PubChem (NCBI)