CAS 1184999-99-2 appears in our catalog under these names: [(5-Methoxy-1h-indol-2-yl)methyl]amine methanesulfonate, 95%, (5-Methoxy-1H-indol-2-yl)methanamine methanesulfonate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
Methanesulfonic acid;(5-methoxy-1H-indol-2-yl)methanamine (CAS 1184999-99-2) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: methanesulfonic acid;(5-methoxy-1H-indol-2-yl)methanamine. InChIKey: FYZYLSTUADOSFC-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | methanesulfonic acid;(5-methoxy-1H-indol-2-yl)methanamine |
| InChIKey | FYZYLSTUADOSFC-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2)CN.CS(=O)(=O)O |
Computed by PubChem (NCBI)