CAS 1332873-09-2 appears in our catalog under these names: 2-(1-[(tert-Butoxycarbonyl)amino]ethyl)-1,3-thiazole-5-carboxylic acid, 95%, 2-(1-{((tert-Butoxy)carbonyl)amino}ethyl)-1,3-thiazole-5-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazole-5-carboxylic acid (CAS 1332873-09-2) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazole-5-carboxylic acid. InChIKey: ICDURVYGDQEDNK-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | 2-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-thiazole-5-carboxylic acid |
| InChIKey | ICDURVYGDQEDNK-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=C(S1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)