Products 1185568-62-0

CAS 1185568-62-0 is the registry number for [2-(2-Methyl-1h-indol-1-yl)ethyl]amine sulfate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-methylindol-1-yl)ethanamine;sulfuric acid (CAS 1185568-62-0) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: 2-(2-methylindol-1-yl)ethanamine;sulfuric acid. InChIKey: VNAFSZUYYYKXGO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16N2O4S
Molecular weight272.32 g/mol
IUPAC name2-(2-methylindol-1-yl)ethanamine;sulfuric acid
InChIKeyVNAFSZUYYYKXGO-UHFFFAOYSA-N
SMILESCC1=CC2=CC=CC=C2N1CCN.OS(=O)(=O)O

Computed by PubChem (NCBI)