CAS 91431-22-0 is the registry number for N,N-Diethyl-4-methyl-3-nitrobenzenesulfonamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
N,N-diethyl-4-methyl-3-nitrobenzenesulfonamide (CAS 91431-22-0) is a chemical compound with the molecular formula C11H16N2O4S and a molecular weight of 272.32 g/mol. IUPAC name: N,N-diethyl-4-methyl-3-nitrobenzenesulfonamide. InChIKey: YGHFQKUPFLTGIF-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4S |
|---|---|
| Molecular weight | 272.32 g/mol |
| IUPAC name | N,N-diethyl-4-methyl-3-nitrobenzenesulfonamide |
| InChIKey | YGHFQKUPFLTGIF-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)