CAS 21012-18-0 appears in our catalog under these names: L-N-Boc-3-pyrazol-1-yl-alanine, 95%, (S)-2-((tert-Butoxycarbonyl)amino)-3-(1H-pyrazol-1-yl)propanoic acid, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyrazol-1-ylpropanoic acid (CAS 21012-18-0) is a chemical compound with the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyrazol-1-ylpropanoic acid. InChIKey: JPGQESMEFISORC-QMMMGPOBSA-N.
| Molecular formula | C11H17N3O4 |
|---|---|
| Molecular weight | 255.27 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-pyrazol-1-ylpropanoic acid |
| InChIKey | JPGQESMEFISORC-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CN1C=CC=N1)C(=O)O |
Computed by PubChem (NCBI)