cas: 7536-55-2 — see every product listed under this CAS number, including other names
Boc-Asn-OH, 98%, 98% (CAS 7536-55-2) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 25kg, 50kg, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ICMJ-1kg |
| cas | 7536-55-2 |
| size | 1kg |
| availability | 50000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 803.60 Pln | |
| Chemat | 25kg | price on request | |
| Chemat | 50kg | price on request | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 50g | 102.80 Pln | |
| Chemat | 100g | 131.60 Pln | |
| Chemat | 250g | 227.60 Pln | |
| Chemat | 500g | 451.20 Pln | |
| Chemat | 5kg | 4108.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 7536-55-2) is a chemical compound with the molecular formula C9H16N2O5 and a molecular weight of 232.23 g/mol. IUPAC name: (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: FYYSQDHBALBGHX-YFKPBYRVSA-N.
| Molecular formula | C9H16N2O5 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | FYYSQDHBALBGHX-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)