cas: 34404-30-3 — see every product listed under this CAS number, including other names
Boc-D-Glu-OBzl, 98% (CAS 34404-30-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A111983-5g |
| cas | 34404-30-3 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 804.25 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 181.07 Pln | |
| BLDpharm | 10g | 203.29 Pln | |
| BLDpharm | 25g | 397.66 Pln | |
| BLDpharm | 100g | 1147.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid (CAS 34404-30-3) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: CVZUKWBYQQYBTF-CYBMUJFWSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | CVZUKWBYQQYBTF-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)O)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)