Products 1030422-06-0

CAS 1030422-06-0 is the registry number for [1-(3,4,5-Trimethoxybenzoyl)piperidin-4-yl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]acetic acid (CAS 1030422-06-0) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: 2-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]acetic acid. InChIKey: MFELEQGPYKOJMK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23NO6
Molecular weight337.4 g/mol
IUPAC name2-[1-(3,4,5-trimethoxybenzoyl)piperidin-4-yl]acetic acid
InChIKeyMFELEQGPYKOJMK-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C(=O)N2CCC(CC2)CC(=O)O

Computed by PubChem (NCBI)