CAS 254101-10-5 appears in our catalog under these names: Boc–?–HoAsp(OBzl)–OH, N-Boc-L-beta-glutamic acid 5-benzyl ester, 95% , Boc-β-HoAsp(OBzl)-OH 95%, Boc-β-Hoasp(Obzl)-OH, 98%, 98%, Boc-β-HoAsp(OBzl)-OH, 98.10%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 100mg, 100 mg, 500 mg.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid (CAS 254101-10-5) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid. InChIKey: FAFJSSKTLCNWRJ-CYBMUJFWSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid |
| InChIKey | FAFJSSKTLCNWRJ-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)CC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)