Products 60079-12-1

CAS 60079-12-1 is the registry number for Z-(MeO)-Asp-OtBu, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.

1-O-tert-butyl 4-O-methyl 2-(phenylmethoxycarbonylamino)butanedioate (CAS 60079-12-1) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 2-(phenylmethoxycarbonylamino)butanedioate. InChIKey: RJPJDIHTCANHNF-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23NO6
Molecular weight337.4 g/mol
IUPAC name1-O-tert-butyl 4-O-methyl 2-(phenylmethoxycarbonylamino)butanedioate
InChIKeyRJPJDIHTCANHNF-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C(CC(=O)OC)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)