CAS 63327-57-1 appears in our catalog under these names: Z-L-Asp(OtBu)-OMe, 95%, 4-(tert-Butyl) 1-methyl ((benzyloxy)carbonyl)-L-aspartate, 98%, Z–Asp(OtBu)–OMe. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 100g, 25g, 1g.
4-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate (CAS 63327-57-1) is a chemical compound with the molecular formula C17H23NO6 and a molecular weight of 337.4 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate. InChIKey: HHCORPWNIMSWJP-ZDUSSCGKSA-N.
| Molecular formula | C17H23NO6 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl (2S)-2-(phenylmethoxycarbonylamino)butanedioate |
| InChIKey | HHCORPWNIMSWJP-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)