cas: 67198-86-1 — see every product listed under this CAS number, including other names
Boc-D-Homoserine lactone 98+% (CAS 67198-86-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1473859-1g |
| cas | 67198-86-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 25g | 1104.63 Pln | |
| Ambeed | 100g | 4030.50 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1473859 |
Tert-butyl N-[(3R)-2-oxooxolan-3-yl]carbamate (CAS 67198-86-1) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: tert-butyl N-[(3R)-2-oxooxolan-3-yl]carbamate. InChIKey: IMWMFJMYEKHYKG-ZCFIWIBFSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | tert-butyl N-[(3R)-2-oxooxolan-3-yl]carbamate |
| InChIKey | IMWMFJMYEKHYKG-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCOC1=O |
Computed by PubChem (NCBI)