cas: 106719-44-2 — see every product listed under this CAS number, including other names
Boc-D-Lys-OH, 98% (CAS 106719-44-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M06187-1G |
| cas | 106719-44-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 414.46 Pln | |
| Fluorochem | 100g | 1388.07 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 106719-44-2) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: (2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: DQUHYEDEGRNAFO-MRVPVSSYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | DQUHYEDEGRNAFO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)