cas: 106719-44-2 — see every product listed under this CAS number, including other names
Boc-D-Lys-OH, 99.91% (CAS 106719-44-2) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011977-10 g |
| cas | 106719-44-2 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 273.25 Pln | |
| MedChemExpress | 100 g | 1332.08 Pln | |
| MedChemExpress | 25 g | 445.08 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.91% |
(2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 106719-44-2) is a chemical compound with the molecular formula C11H22N2O4 and a molecular weight of 246.30 g/mol. IUPAC name: (2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: DQUHYEDEGRNAFO-MRVPVSSYSA-N.
| Molecular formula | C11H22N2O4 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | DQUHYEDEGRNAFO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCCN)C(=O)O |
Computed by PubChem (NCBI)