Boc-D-Phg(4-Cl)-OH, 98%, 98%
cas: 53994-85-7 — see every product listed under this CAS number, including other names
Boc-D-Phg(4-Cl)-OH, 98%, 98% (CAS 53994-85-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9F7-100mg |
| cas | 53994-85-7 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1648.40 Pln | |
| Chemat | 25g | 5306.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 53994-85-7) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: (2R)-2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZZONJNNLTAGSHB-SNVBAGLBSA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | (2R)-2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZZONJNNLTAGSHB-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-((tert-Butoxycarbonyl)amino)-2-(4-chlorophenyl)acetic acid, Boc-D-Phg(4-Cl)-OH, N-Boc-(4'-chlorophenyl)glycine, (2R)-2-(4-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid, N-Boc-2-(4'-Chlorophenyl)-D-glycine, tert-Butoxycarbonylamino-(4-chloro-phenyl)-acetic acid, (R)-4-Chloro-a-(Boc-amino)benzeneacetic acid, (R)-4-Chloro-alpha-(Boc-amino)benzeneacetic acid, (R)-2-(Boc-amino)-2-(4-chlorophenyl)acetic Acid, N-(tert-Butoxycarbonyl)-D-2-(4-chlorophenyl)glycine