cas: 55674-67-4 — see every product listed under this CAS number, including other names
Boc-D-Thr-OH 95% (CAS 55674-67-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A165896-250mg |
| cas | 55674-67-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 526.12 Pln | |
| Ambeed | 100g | 1794.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A165896 |
(2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 55674-67-4) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LLHOYOCAAURYRL-NTSWFWBYSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2R,3S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LLHOYOCAAURYRL-NTSWFWBYSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)