Boc-DL-β-Phe-OH, 98%
cas: 14676-01-8 — see every product listed under this CAS number, including other names
Boc-DL-β-Phe-OH, 98% (CAS 14676-01-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 10g, 50g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A490094-1g |
| cas | 14676-01-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 693.00 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 142.20 Pln | |
| BLDpharm | 25g | 275.48 Pln | |
| BLDpharm | 100g | 741.99 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 50g | 669.20 Pln | |
| Chemat | 100g | 1096.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 14676-01-8) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: JTNQFJPZRTURSI-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | JTNQFJPZRTURSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
3-{[(tert-butoxy)carbonyl]amino}-3-phenylpropanoic acid, 3-(((tert-butoxy)carbonyl)amino)-3-phenylpropanoic acid, 3-(Boc-Amino)-3-phenylpropionic acid, Boc-DL-beta-Phe-OH, Boc-DL-|A-Phe-OH, 3-N-Boc-3-Phenylpropionic acid, 3-((tert-Butoxycarbonyl)amino)-3-phenylpropanoic acid, 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid, 3-[(tert-butoxycarbonyl)amino]-3-phenylpropanoic acid, Boc-3-amino-3-phenylpropionic acid
