CAS 161024-80-2 appears in our catalog under these names: (R)–3–((tert–Butoxycarbonyl)amino)–3–phenylpropanoic acid, (R)-3-(Boc-amino)-3-phenylpropionic acid, 95% , Boc-β-Phe-OH 97%, (R)-N-Boc-3-Amino-3-phenylpropanoic acid, 97%, 97%, (R)-3-((tert-Butoxycarbonyl)amino)-3-phenylpropanoic acid, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g, 50g, 100g.
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 161024-80-2) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: JTNQFJPZRTURSI-LLVKDONJSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | JTNQFJPZRTURSI-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)