CAS 103365-47-5 appears in our catalog under these names: (S)-N-Boc-3-amino-3-phenylpropanoic acid, 98%, (S)–3–((tert–Butoxycarbonyl)amino)–3–phenylpropanoic acid, (S)-3-(Boc-amino)-3-phenylpropionic acid, 95% , Boc-D-β-Phe-OH 98%, (S)-N-Boc-3-amino-3-phenylpropanoic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 103365-47-5) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: JTNQFJPZRTURSI-NSHDSACASA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | JTNQFJPZRTURSI-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)