Boc-L-Leucine hydrate, 95%
cas: 200936-87-4 — see every product listed under this CAS number, including other names
Boc-L-Leucine hydrate, 95% (CAS 200936-87-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300510-25G |
| cas | 200936-87-4 |
| size | 25g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 133.30 Pln | |
| Fluorochem | 500g | 331.15 Pln | |
| Fluorochem | 1kg | 607.10 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate (CAS 200936-87-4) is a chemical compound with the molecular formula C11H23NO5 and a molecular weight of 249.30 g/mol. IUPAC name: (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate. InChIKey: URQQEIOTRWJXBA-QRPNPIFTSA-N.
| Molecular formula | C11H23NO5 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| InChIKey | URQQEIOTRWJXBA-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)
Synonyms:
N-Boc-L-leucine hydrate, (S)-2-((tert-Butoxycarbonyl)amino)-4-methylpentanoic acid hydrate, Boc-L-Leucine hydrate, Boc-Leu-OH.H2O, Boc-Leu-OH inverted exclamation mark currencyH2O, N-(tert-Butoxycarbonyl)-L-leucine monohydrate, t-butoxycarbonyl-l-leucine hydrate, N-(tert-butoxycabonyl)-L-leucine monohydrate, N-t-butoxycarbonyl-(L)-leucine mono-hydrate, (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate