Boc-Leu-OH (hydrate), 98.89%
cas: 200936-87-4 — see every product listed under this CAS number, including other names
Boc-Leu-OH (hydrate), 98.89% (CAS 200936-87-4) is a chemical reagent available from Chemat. Available pack sizes: 500 g, 1 kg, 10 g, 25 g, 100 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W101495-500 g |
| cas | 200936-87-4 |
| size | 500 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 g | 556.54 Pln | |
| MedChemExpress | 1 kg | 816.60 Pln | |
| MedChemExpress | 10 g | 240.74 Pln | |
| MedChemExpress | 25 g | 277.90 Pln | |
| MedChemExpress | 100 g | 407.93 Pln | |
| MedChemExpress | 50 g | 333.62 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.89% |
(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate (CAS 200936-87-4) is a chemical compound with the molecular formula C11H23NO5 and a molecular weight of 249.30 g/mol. IUPAC name: (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate. InChIKey: URQQEIOTRWJXBA-QRPNPIFTSA-N.
| Molecular formula | C11H23NO5 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| InChIKey | URQQEIOTRWJXBA-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)
Synonyms:
N-Boc-L-leucine hydrate, (S)-2-((tert-Butoxycarbonyl)amino)-4-methylpentanoic acid hydrate, Boc-L-Leucine hydrate, Boc-Leu-OH.H2O, Boc-Leu-OH inverted exclamation mark currencyH2O, N-(tert-Butoxycarbonyl)-L-leucine monohydrate, t-butoxycarbonyl-l-leucine hydrate, N-(tert-butoxycabonyl)-L-leucine monohydrate, N-t-butoxycarbonyl-(L)-leucine mono-hydrate, (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate