cas: 200936-87-4 — see every product listed under this CAS number, including other names
L-Leucine, N-[(1,1-dimethylethoxy)carbonyl]-, hydrate (1:1), 95%, 95% (CAS 200936-87-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1kg, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113D4T-10g |
| cas | 200936-87-4 |
| size | 10g |
| availability | 4000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 78.80 Pln | |
| Chemat | 1kg | 549.20 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 98.00 Pln | |
| Chemat | 500g | 316.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate (CAS 200936-87-4) is a chemical compound with the molecular formula C11H23NO5 and a molecular weight of 249.30 g/mol. IUPAC name: (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate. InChIKey: URQQEIOTRWJXBA-QRPNPIFTSA-N.
| Molecular formula | C11H23NO5 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| InChIKey | URQQEIOTRWJXBA-QRPNPIFTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)