cas: 34582-32-6 — see every product listed under this CAS number, including other names
Boc-L-aspartic acid 1-tert-butyl ester, 98%, 98% (CAS 34582-32-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg, 5kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140HK-1g |
| cas | 34582-32-6 |
| size | 1g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 184.40 Pln | |
| Chemat | 100g | 549.20 Pln | |
| Chemat | 500g | 2558.40 Pln | |
| Chemat | 1kg | 5032.40 Pln | |
| Chemat | 5kg | 15600.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (CAS 34582-32-6) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid. InChIKey: RAUQRYTYJIYLTF-QMMMGPOBSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (3S)-4-[(2-methylpropan-2-yl)oxy]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| InChIKey | RAUQRYTYJIYLTF-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)