Boc-L-glutamic acid 1-tert-butyl ester, 98%
cas: 24277-39-2 — see every product listed under this CAS number, including other names
Boc-L-glutamic acid 1-tert-butyl ester, 98% (CAS 24277-39-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146YG-1g |
| cas | 24277-39-2 |
| size | 1g |
| availability | 25000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 50g | 203.60 Pln | |
| Chemat | 100g | 323.60 Pln | |
| Chemat | 500g | 1372.80 Pln | |
| Chemat | 1kg | 2622.80 Pln | |
| Chemat | 5kg | 10435.20 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 24277-39-2) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: (4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: YMOYURYWGUWMFM-VIFPVBQESA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (4S)-5-[(2-methylpropan-2-yl)oxy]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | YMOYURYWGUWMFM-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
N-(tert-Butoxycarbonyl)-L-glutamic Acid 1-tert-Butyl Ester, (4S)-5-(tert-butoxy)-4-(((tert-butoxy)carbonyl)amino)-5-oxopentanoic acid, (4S)-5-(tert-butoxy)-4-[[(tert-butoxy)carbonyl]amino]-5-oxopentanoic acid, Boc-Glu-OtBu, Boc-L-glutamic acid 1-tert-butyl ester, (S)-5-(tert-butoxy)-4-((tert-butoxycarbonyl)amino)-5-oxopentanoic acid, N-BOC-glutamic acid tert-butyl ester, N-Boc-L-glutamic acid 1-tert-butyl ester, 1-tert-Butyl N-Boc-L-glutamate, N-Boc-L-glutamic Acid tert-Butyl Ester
