cas: 113400-36-5 — see every product listed under this CAS number, including other names
Boc-L-pyroglutamic Acid Benzyl Ester, 97%, 97% (CAS 113400-36-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1119FP-1g |
| cas | 113400-36-5 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 93.20 Pln | |
| Chemat | 500g | 283.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-O-benzyl 1-O-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 113400-36-5) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: TZNBTMCEMLXYEM-ZDUSSCGKSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2S)-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | TZNBTMCEMLXYEM-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CCC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)