CAS 141871-02-5 appears in our catalog under these names: Boc–N–Me–Abz–OH, 2-((tert-Butoxycarbonyl)(methyl)amino)benzoic acid, 98%, 98%, 2-(tert-Butoxycarbonyl-methyl-amino)-benzoic acid, 97%, Boc-N-Me-2-Abz-OH, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid (CAS 141871-02-5) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid. InChIKey: UXLICAHPTWWCII-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid |
| InChIKey | UXLICAHPTWWCII-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)