cas: 21887-64-9 — see every product listed under this CAS number, including other names
Boc-Orn-OH, 95% (CAS 21887-64-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 20g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03343-5G |
| cas | 21887-64-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 10g | 174.96 Pln | |
| Fluorochem | 20g | 263.47 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 893.45 Pln | |
| Fluorochem | 500g | 4038.18 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 21887-64-9) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: AMPVNPYPOOQUJF-ZETCQYMHSA-N.
| Molecular formula | C10H20N2O4 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (2S)-5-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | AMPVNPYPOOQUJF-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN)C(=O)O |
Computed by PubChem (NCBI)