Products 58534-57-9

CAS 58534-57-9 is the registry number for 2,2'-((6-Aminohexyl)azanediyl)diacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[6-aminohexyl(carboxymethyl)amino]acetic acid (CAS 58534-57-9) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: 2-[6-aminohexyl(carboxymethyl)amino]acetic acid. InChIKey: JRNZDINJIDNOLX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20N2O4
Molecular weight232.28 g/mol
IUPAC name2-[6-aminohexyl(carboxymethyl)amino]acetic acid
InChIKeyJRNZDINJIDNOLX-UHFFFAOYSA-N
SMILESC(CCCN(CC(=O)O)CC(=O)O)CCN

Computed by PubChem (NCBI)