cas: 82278-73-7 — see every product listed under this CAS number, including other names
Boc-Phe(3-Br)-OH, 97% (CAS 82278-73-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149F6-1g |
| cas | 82278-73-7 |
| size | 1g |
| availability | 726.55g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 266.00 Pln | |
| Chemat | 50g | 448.40 Pln | |
| Chemat | 100g | 784.40 Pln | |
| Chemat | 250g | 1600.40 Pln | |
| Chemat | 500g | 2683.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 82278-73-7) is a chemical compound with the molecular formula C14H18BrNO4 and a molecular weight of 344.20 g/mol. IUPAC name: (2S)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: FBUDYESOPLBQIR-NSHDSACASA-N.
| Molecular formula | C14H18BrNO4 |
|---|---|
| Molecular weight | 344.20 g/mol |
| IUPAC name | (2S)-3-(3-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | FBUDYESOPLBQIR-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)Br)C(=O)O |
Computed by PubChem (NCBI)