cas: 26250-84-0 — see every product listed under this CAS number, including other names
Boc-Pip-OH, 98%, 98% (CAS 26250-84-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1kg, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CJT-5g |
| cas | 26250-84-0 |
| size | 5g |
| availability | 3000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 136.40 Pln | |
| Chemat | 100g | 362.00 Pln | |
| Chemat | 500g | 1569.60 Pln | |
| Chemat | 1kg | 2862.80 Pln | |
| Chemat | 50g | 213.20 Pln | |
| Chemat | 250g | 798.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 26250-84-0) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: JQAOHGMPAAWWQO-QMMMGPOBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | JQAOHGMPAAWWQO-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)