CAS 28697-17-8 appears in our catalog under these names: Boc–D–Homopro–OH, Boc-D-Pip-OH, N-Boc-D-pipecolinic acid, 98% , Boc-D-HoPro-OH 95%, (R)-(+)-N-Boc-2-piperidinecarboxylic Acid, 95%, 95%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 10g, 100g, 500g, 1000g.
(2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid (CAS 28697-17-8) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid. InChIKey: JQAOHGMPAAWWQO-MRVPVSSYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid |
| InChIKey | JQAOHGMPAAWWQO-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@@H]1C(=O)O |
Computed by PubChem (NCBI)