Boc-cycloleucine, 98.0%
cas: 35264-09-6 — see every product listed under this CAS number, including other names
Boc-cycloleucine, 98.0% (CAS 35264-09-6) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W007993-10 g |
| cas | 35264-09-6 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 5 g | 240.74 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 35264-09-6) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: YBZCSKVLXBOFSL-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | YBZCSKVLXBOFSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCCC1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-tert-butoxycarbonylaminocyclopentanecarboxylic acid, Boc-cycloleucine, 1-(Boc-amino)cyclopentanecarboxylic acid, 1-((tert-Butoxycarbonyl)amino)cyclopentanecarboxylic acid, 1-N-Boc-Aminocyclopentanecarboxylic acid, Boc-1-aminocyclopentane-1-carboxylic acid, 1-(tert-Butoxycarbonylamino)cyclopentanecarboxylic Acid, N-Boc-cycloleucine, 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic Acid, 1-((tert-butoxycarbonyl)amino)cyclopentane-1-carboxylic acid