cas: 35264-09-6 — see every product listed under this CAS number, including other names
Boc-cycloleucine, 98% (CAS 35264-09-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g, 5g, 100g, 1g, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-4723-25g |
| cas | 35264-09-6 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 154.13 Pln | |
| Fluorochem | 10g | 190.58 Pln | |
| Fluorochem | 25g | 388.42 Pln | |
| Fluorochem | 100g | 1393.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 35264-09-6) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: YBZCSKVLXBOFSL-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | YBZCSKVLXBOFSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCCC1)C(=O)O |
Computed by PubChem (NCBI)