cas: 267876-09-5 — see every product listed under this CAS number, including other names
Boc-trans-4-(2-pyridinyl)-pyrrolidine-3-carboxylic acid, 95%, 95% (CAS 267876-09-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C4LD-1g |
| cas | 267876-09-5 |
| size | 1g |
| availability | 331g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 4043.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-pyridin-2-ylpyrrolidine-3-carboxylic acid (CAS 267876-09-5) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: (3R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-pyridin-2-ylpyrrolidine-3-carboxylic acid. InChIKey: BCVDNYNGCYPVGC-QWRGUYRKSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | (3R,4R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-pyridin-2-ylpyrrolidine-3-carboxylic acid |
| InChIKey | BCVDNYNGCYPVGC-QWRGUYRKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)O)C2=CC=CC=N2 |
Computed by PubChem (NCBI)