cas: 681128-50-7 — see every product listed under this CAS number, including other names
Boc-trans-D-4-F-Pro-OH 95% (CAS 681128-50-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A147188-100mg |
| cas | 681128-50-7 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 876.56 Pln | |
| Ambeed | 10g | 1677.56 Pln | |
| Ambeed | 25g | 4086.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A147188 |
(2R,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 681128-50-7) is a chemical compound with the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. IUPAC name: (2R,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: YGWZXQOYEBWUTH-NKWVEPMBSA-N.
| Molecular formula | C10H16FNO4 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | (2R,4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | YGWZXQOYEBWUTH-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@@H]1C(=O)O)F |
Computed by PubChem (NCBI)