Products 280129-83-1
CAS 280129-83-1 appears in our catalog under these names: Brassinazole/ 99.71% (existing batch purity), Brassinazole, Brassinazole, 99.94%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 25mg, 5mg, 25 mg, 5 mg, 10mM/1mL, 10 mg.
(2S,3R)-4-(4-chlorophenyl)-2-phenyl-3-(1,2,4-triazol-1-yl)butan-2-ol (CAS 280129-83-1) is a chemical compound with the molecular formula C18H18ClN3O and a molecular weight of 327.8 g/mol. IUPAC name: (2S,3R)-4-(4-chlorophenyl)-2-phenyl-3-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: YULDTPKHZNKFEY-MSOLQXFVSA-N.
| Molecular formula | C18H18ClN3O |
|---|---|
| Molecular weight | 327.8 g/mol |
| IUPAC name | (2S,3R)-4-(4-chlorophenyl)-2-phenyl-3-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | YULDTPKHZNKFEY-MSOLQXFVSA-N |
| SMILES | C[C@](C1=CC=CC=C1)([C@@H](CC2=CC=C(C=C2)Cl)N3C=NC=N3)O |
Computed by PubChem (NCBI)