Butyl 2-acetoxybenzoate, 95%
cas: 52602-16-1 — see every product listed under this CAS number, including other names
Butyl 2-acetoxybenzoate, 95% (CAS 52602-16-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1722646-250mg |
| cas | 52602-16-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1160.25 Pln | |
| Ambeed | 1g | 3134.94 Pln | |
| BLDpharm | 100mg | 675.34 Pln | |
| BLDpharm | 250mg | 1136.29 Pln | |
| BLDpharm | 1g | 3068.94 Pln | |
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 990.80 Pln | |
| Chemat | 1g | 2661.20 Pln | |
| Fluorochem | 100mg | 1122.54 Pln | |
| Fluorochem | 250mg | 1830.62 Pln | |
| Fluorochem | 1g | 4928.49 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Butyl 2-acetyloxybenzoate (CAS 52602-16-1) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: butyl 2-acetyloxybenzoate. InChIKey: YDQOBYGKVPXOEF-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | butyl 2-acetyloxybenzoate |
| InChIKey | YDQOBYGKVPXOEF-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=CC=CC=C1OC(=O)C |
Computed by PubChem (NCBI)