cas: 72150-35-7 — see every product listed under this CAS number, including other names
Bz-Phe-NH2, 97%(HPLC),RG, 97%(HPLC),RG (CAS 72150-35-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116JT2-100mg |
| cas | 72150-35-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 501.20 Pln | |
| Chemat | 5g | 1619.60 Pln |
| purity | 97%(HPLC),RG |
|---|---|
| delivery time | 3 weeks |
N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]benzamide (CAS 72150-35-7) is a chemical compound with the molecular formula C16H16N2O2 and a molecular weight of 268.31 g/mol. IUPAC name: N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]benzamide. InChIKey: GDJKEUNPXYLPHG-AWEZNQCLSA-N.
| Molecular formula | C16H16N2O2 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | N-[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]benzamide |
| InChIKey | GDJKEUNPXYLPHG-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)