cas: 91902-97-5 — see every product listed under this CAS number, including other names
CARBONIC ACID, ETHYL 2-NAPHTHALENYL ESTER, 95%, 95% (CAS 91902-97-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11409B-250mg |
| cas | 91902-97-5 |
| size | 250mg |
| availability | 15.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 3165.20 Pln | |
| Chemat | 10g | 5435.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl naphthalen-2-yl carbonate (CAS 91902-97-5) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: ethyl naphthalen-2-yl carbonate. InChIKey: VMRNKKFNOFXEMB-UHFFFAOYSA-N.
| Molecular formula | C13H12O3 |
|---|---|
| Molecular weight | 216.23 g/mol |
| IUPAC name | ethyl naphthalen-2-yl carbonate |
| InChIKey | VMRNKKFNOFXEMB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)OC1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)