CAS 883098-58-6 appears in our catalog under these names: CCT129957/ 99.44% (existing batch purity), CCT129957, CCT129957 98%, 7-Nitro-N-phenethyl-1H-indole-2-carboxamide, 95%, 95%, CCT129957, 99.71%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
7-nitro-N-(2-phenylethyl)-1H-indole-2-carboxamide (CAS 883098-58-6) is a chemical compound with the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. IUPAC name: 7-nitro-N-(2-phenylethyl)-1H-indole-2-carboxamide. InChIKey: VXDJRTJBOJFUOC-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O3 |
|---|---|
| Molecular weight | 309.32 g/mol |
| IUPAC name | 7-nitro-N-(2-phenylethyl)-1H-indole-2-carboxamide |
| InChIKey | VXDJRTJBOJFUOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNC(=O)C2=CC3=C(N2)C(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)