Products 2374831-10-2
CAS 2374831-10-2 appears in our catalog under these names: CDC25B-IN-1/ 97.86% (existing batch purity), CDC25B-IN-1, CDC25B-IN-1 98%, CDC25B-IN-1, 98.12%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 100 mg.
Ethyl 3-[(3-methoxynaphthalen-1-yl)amino]benzoate (CAS 2374831-10-2) is a chemical compound with the molecular formula C20H19NO3 and a molecular weight of 321.4 g/mol. IUPAC name: ethyl 3-[(3-methoxynaphthalen-1-yl)amino]benzoate. InChIKey: UCMCQFKDMRVNDS-UHFFFAOYSA-N.
| Molecular formula | C20H19NO3 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | ethyl 3-[(3-methoxynaphthalen-1-yl)amino]benzoate |
| InChIKey | UCMCQFKDMRVNDS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)NC2=CC(=CC3=CC=CC=C32)OC |
Computed by PubChem (NCBI)