cas: 18711-15-4 — see every product listed under this CAS number, including other names
CFL-120 98% (CAS 18711-15-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194513-1g |
| cas | 18711-15-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 292.50 Pln | |
| Ambeed | 25g | 531.69 Pln | |
| Ambeed | 100g | 1549.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A194513 |
4,6-dichloro-1H-indole-2,3-dione (CAS 18711-15-4) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 4,6-dichloro-1H-indole-2,3-dione. InChIKey: CGCVHJCZBIYRQC-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 4,6-dichloro-1H-indole-2,3-dione |
| InChIKey | CGCVHJCZBIYRQC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C2=O)Cl)Cl |
Computed by PubChem (NCBI)