CFL-120, 98.24%
cas: 18711-15-4 — see every product listed under this CAS number, including other names
CFL-120, 98.24% (CAS 18711-15-4) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 1 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W041315-10 g |
| cas | 18711-15-4 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 431.15 Pln | |
| MedChemExpress | 25 g | 598.33 Pln | |
| MedChemExpress | 1 g | 263.96 Pln | |
| MedChemExpress | 5 g | 361.49 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.24% |
4,6-dichloro-1H-indole-2,3-dione (CAS 18711-15-4) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 4,6-dichloro-1H-indole-2,3-dione. InChIKey: CGCVHJCZBIYRQC-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 4,6-dichloro-1H-indole-2,3-dione |
| InChIKey | CGCVHJCZBIYRQC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C2=O)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
4,6-Dichloroisatin, 4,6-Dichloro-1H-indole-2,3-dione, 4,6-dichloro-2,3-dihydro-1H-indole-2,3-dione, 46-Dichloroisatin, 4,6-dichlorisatin, 1H-Indole-2,3-dione,4,6-dichloro-, Isatin-based compound, 50, 4,6-dichloro-1H-benzo[d]azoline-2,3-dione, 4,6-dichloroindolin-2,3-dione, 4,6-Dichloro-2,3-indolinedione