cas: 18711-15-4 — see every product listed under this CAS number, including other names
4,6-Dichloroisatin, 95% (CAS 18711-15-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079343-5G |
| cas | 18711-15-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 190.58 Pln | |
| Fluorochem | 10g | 200.99 Pln | |
| Fluorochem | 25g | 419.66 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,6-dichloro-1H-indole-2,3-dione (CAS 18711-15-4) is a chemical compound with the molecular formula C8H3Cl2NO2 and a molecular weight of 216.02 g/mol. IUPAC name: 4,6-dichloro-1H-indole-2,3-dione. InChIKey: CGCVHJCZBIYRQC-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2NO2 |
|---|---|
| Molecular weight | 216.02 g/mol |
| IUPAC name | 4,6-dichloro-1H-indole-2,3-dione |
| InChIKey | CGCVHJCZBIYRQC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C2=O)Cl)Cl |
Computed by PubChem (NCBI)